C7H14OS — CID 13081675
(3R,4S)-3-ethylthian-4-ol (PubChem CID 13081675) has the molecular formula C7H14OS and a molecular weight of 146.25 g/mol. Its IUPAC name is (3R,4S)-3-ethylthian-4-ol.
| Compound Name | (3R,4S)-3-ethylthian-4-ol |
|---|---|
| PubChem CID | 13081675 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (3R,4S)-3-ethylthian-4-ol |
| SMILES | CC[C@H]1CSCC[C@@H]1O |
| InChI | InChI=1S/C7H14OS/c1-2-6-5-9-4-3-7(6)8/h6-8H,2-5H2,1H3/t6-,7-/m0/s1 |
| InChIKey | UVINTRKEOLRROH-BQBZGAKWSA-N |
| XLogP | 1.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |