C7H12O3S — CID 96630079
2-[(3R,4S)-3-hydroxythian-4-yl]acetic acid (PubChem CID 96630079) has the molecular formula C7H12O3S and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-[(3R,4S)-3-hydroxythian-4-yl]acetic acid.
| Compound Name | 2-[(3R,4S)-3-hydroxythian-4-yl]acetic acid |
|---|---|
| PubChem CID | 96630079 |
| Molecular Formula | C7H12O3S |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 2-[(3R,4S)-3-hydroxythian-4-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CCSC[C@@H]1O |
| InChI | InChI=1S/C7H12O3S/c8-6-4-11-2-1-5(6)3-7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | CPRDBQSZRKBCTO-RITPCOANSA-N |
| XLogP | 0.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |