C8H11BrN2O — CID 130831733
N-[(4-bromo-1H-pyrrol-2-yl)methyl]propanamide (PubChem CID 130831733) has the molecular formula C8H11BrN2O and a molecular weight of 231.09 g/mol. Its IUPAC name is N-[(4-bromo-1H-pyrrol-2-yl)methyl]propanamide.
| Compound Name | N-[(4-bromo-1H-pyrrol-2-yl)methyl]propanamide |
|---|---|
| PubChem CID | 130831733 |
| Molecular Formula | C8H11BrN2O |
| Molecular Weight | 231.09 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | N-[(4-bromo-1H-pyrrol-2-yl)methyl]propanamide |
| SMILES | CCC(=O)NCc1cc(Br)c[nH]1 |
| InChI | InChI=1S/C8H11BrN2O/c1-2-8(12)11-5-7-3-6(9)4-10-7/h3-4,10H,2,5H2,1H3,(H,11,12) |
| InChIKey | UJWOFORFEKIGLP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.09 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |