C7H8BrClN2O — CID 130614550
N-[(4-bromo-1H-pyrrol-2-yl)methyl]-2-chloroacetamide (PubChem CID 130614550) has the molecular formula C7H8BrClN2O and a molecular weight of 251.51 g/mol. Its IUPAC name is N-[(4-bromo-1H-pyrrol-2-yl)methyl]-2-chloroacetamide.
| Compound Name | N-[(4-bromo-1H-pyrrol-2-yl)methyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 130614550 |
| Molecular Formula | C7H8BrClN2O |
| Molecular Weight | 251.51 g/mol |
| Exact Mass | 249.95 |
| IUPAC Name | N-[(4-bromo-1H-pyrrol-2-yl)methyl]-2-chloroacetamide |
| SMILES | O=C(CCl)NCc1cc(Br)c[nH]1 |
| InChI | InChI=1S/C7H8BrClN2O/c8-5-1-6(10-3-5)4-11-7(12)2-9/h1,3,10H,2,4H2,(H,11,12) |
| InChIKey | PYGNTDMCRXGWIT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|