C10H11BrClNO4S — CID 13210266
N-[(5-bromo-2-hydroxy-3-methylsulfonylphenyl)methyl]-2-chloroacetamide (PubChem CID 13210266) has the molecular formula C10H11BrClNO4S and a molecular weight of 356.63 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxy-3-methylsulfonylphenyl)methyl]-2-chloroacetamide.
| Compound Name | N-[(5-bromo-2-hydroxy-3-methylsulfonylphenyl)methyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 13210266 |
| Molecular Formula | C10H11BrClNO4S |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 354.93 |
| IUPAC Name | N-[(5-bromo-2-hydroxy-3-methylsulfonylphenyl)methyl]-2-chloroacetamide |
| SMILES | CS(=O)(=O)c1cc(Br)cc(CNC(=O)CCl)c1O |
| InChI | InChI=1S/C10H11BrClNO4S/c1-18(16,17)8-3-7(11)2-6(10(8)15)5-13-9(14)4-12/h2-3,15H,4-5H2,1H3,(H,13,14) |
| InChIKey | VICAMOHCZLJVDT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|