C7H10ClN3O2 — CID 130892989
2-chloro-N-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]acetamide (PubChem CID 130892989) has the molecular formula C7H10ClN3O2 and a molecular weight of 203.63 g/mol. Its IUPAC name is 2-chloro-N-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]acetamide.
| Compound Name | 2-chloro-N-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]acetamide |
|---|---|
| PubChem CID | 130892989 |
| Molecular Formula | C7H10ClN3O2 |
| Molecular Weight | 203.63 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 2-chloro-N-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]acetamide |
| SMILES | Cn1[nH]c(CNC(=O)CCl)cc1=O |
| InChI | InChI=1S/C7H10ClN3O2/c1-11-7(13)2-5(10-11)4-9-6(12)3-8/h2,10H,3-4H2,1H3,(H,9,12) |
| InChIKey | GSPBRJOXHRGWPN-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.63 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|