C8H15N5O — CID 131008226
1,2-dimethyl-3-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]guanidine (PubChem CID 131008226) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 131008226 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 1,2-dimethyl-3-[(2-methyl-3-oxo-1H-pyrazol-5-yl)methyl]guanidine |
| SMILES | C/N=C(\NC)NCc1cc(=O)n(C)[nH]1 |
| InChI | InChI=1S/C8H15N5O/c1-9-8(10-2)11-5-6-4-7(14)13(3)12-6/h4,12H,5H2,1-3H3,(H2,9,10,11) |
| InChIKey | ZBSDEUCSNBCPAU-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|