C11H19IN4O — CID 120605821
1-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-2,3-dimethylguanidine;hydroiodide (PubChem CID 120605821) has the molecular formula C11H19IN4O and a molecular weight of 350.20 g/mol. Its IUPAC name is 1-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-2,3-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-2,3-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120605821 |
| Molecular Formula | C11H19IN4O |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 1-[(1-ethyl-2-oxo-3-pyridinyl)methyl]-2,3-dimethylguanidine;hydroiodide |
| SMILES | CCn1cccc(CN/C(=N/C)NC)c1=O.I |
| InChI | InChI=1S/C11H18N4O.HI/c1-4-15-7-5-6-9(10(15)16)8-14-11(12-2)13-3;/h5-7H,4,8H2,1-3H3,(H2,12,13,14);1H |
| InChIKey | MDEUUDDHXRSTBB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 58.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|