C16H20IN3S — CID 111108902
1,2-dimethyl-3-[(2-phenylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111108902) has the molecular formula C16H20IN3S and a molecular weight of 413.33 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(2-phenylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[(2-phenylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111108902 |
| Molecular Formula | C16H20IN3S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 1,2-dimethyl-3-[(2-phenylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NC)NCc1ccccc1Sc1ccccc1.I |
| InChI | InChI=1S/C16H19N3S.HI/c1-17-16(18-2)19-12-13-8-6-7-11-15(13)20-14-9-4-3-5-10-14;/h3-11H,12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | OUNAUNGJKAFWEH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|