C22H37N3O3 — CID 177147488
N-[[3-[(butanoylamino)methyl]-5-[(propanoylamino)methyl]phenyl]methyl]butanamide;ethane (PubChem CID 177147488) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[[3-[(butanoylamino)methyl]-5-[(propanoylamino)methyl]phenyl]methyl]butanamide;ethane.
| Compound Name | N-[[3-[(butanoylamino)methyl]-5-[(propanoylamino)methyl]phenyl]methyl]butanamide;ethane |
|---|---|
| PubChem CID | 177147488 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | N-[[3-[(butanoylamino)methyl]-5-[(propanoylamino)methyl]phenyl]methyl]butanamide;ethane |
| SMILES | CC.CCCC(=O)NCc1cc(CNC(=O)CC)cc(CNC(=O)CCC)c1 |
| InChI | InChI=1S/C20H31N3O3.C2H6/c1-4-7-19(25)22-13-16-9-15(12-21-18(24)6-3)10-17(11-16)14-23-20(26)8-5-2;1-2/h9-11H,4-8,12-14H2,1-3H3,(H,21,24)(H,22,25)(H,23,26);1-2H3 |
| InChIKey | CERDHBGKEQCAEX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |