C6H9N7 — CID 130834615
1-[(3-methylimidazol-4-yl)methyl]tetrazol-5-amine (PubChem CID 130834615) has the molecular formula C6H9N7 and a molecular weight of 179.19 g/mol. Its IUPAC name is 1-[(3-methylimidazol-4-yl)methyl]tetrazol-5-amine.
| Compound Name | 1-[(3-methylimidazol-4-yl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 130834615 |
| Molecular Formula | C6H9N7 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-[(3-methylimidazol-4-yl)methyl]tetrazol-5-amine |
| SMILES | Cn1cncc1Cn1nnnc1N |
| InChI | InChI=1S/C6H9N7/c1-12-4-8-2-5(12)3-13-6(7)9-10-11-13/h2,4H,3H2,1H3,(H2,7,9,11) |
| InChIKey | VBQOLHMCVWCYOZ-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |