C11H18O2 — CID 130834786
(2R,3R)-3-ethylbicyclo[2.2.2]octane-2-carboxylic acid (PubChem CID 130834786) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (2R,3R)-3-ethylbicyclo[2.2.2]octane-2-carboxylic acid.
| Compound Name | (2R,3R)-3-ethylbicyclo[2.2.2]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 130834786 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (2R,3R)-3-ethylbicyclo[2.2.2]octane-2-carboxylic acid |
| SMILES | CC[C@@H]1C2CCC(CC2)[C@H]1C(=O)O |
| InChI | InChI=1S/C11H18O2/c1-2-9-7-3-5-8(6-4-7)10(9)11(12)13/h7-10H,2-6H2,1H3,(H,12,13)/t7?,8?,9-,10-/m1/s1 |
| InChIKey | UQHHKZXFTHRGIE-YDYPAMBWSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |