C6H9ClO2 — CID 125452531
(1R,2R,3S)-2-chloro-3-ethylcyclopropane-1-carboxylic acid (PubChem CID 125452531) has the molecular formula C6H9ClO2 and a molecular weight of 148.59 g/mol. Its IUPAC name is (1R,2R,3S)-2-chloro-3-ethylcyclopropane-1-carboxylic acid.
| Compound Name | (1R,2R,3S)-2-chloro-3-ethylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 125452531 |
| Molecular Formula | C6H9ClO2 |
| Molecular Weight | 148.59 g/mol |
| Exact Mass | 148.03 |
| IUPAC Name | (1R,2R,3S)-2-chloro-3-ethylcyclopropane-1-carboxylic acid |
| SMILES | CC[C@@H]1[C@@H](Cl)[C@H]1C(=O)O |
| InChI | InChI=1S/C6H9ClO2/c1-2-3-4(5(3)7)6(8)9/h3-5H,2H2,1H3,(H,8,9)/t3-,4-,5+/m0/s1 |
| InChIKey | ISMAHACOZMEGFP-VAYJURFESA-N |
| XLogP | 1.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|