C8H8O4 — CID 130835372
(1S,6R)-3-methoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 130835372) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (1S,6R)-3-methoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1S,6R)-3-methoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 130835372 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (1S,6R)-3-methoxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | COC1=C(C)C(=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C8H8O4/c1-3-4(9)7-8(12-7)5(10)6(3)11-2/h7-8H,1-2H3/t7-,8+/m0/s1 |
| InChIKey | FZUCHXLDZKXEKV-JGVFFNPUSA-N |
| XLogP | -0.17 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|