C8H8O3 — CID 130028048
3,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 130028048) has the molecular formula C8H8O3 and a molecular weight of 152.15 g/mol. Its IUPAC name is 3,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 3,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 130028048 |
| Molecular Formula | C8H8O3 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 3,4-dimethyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC1=C(C)C(=O)C2OC2C1=O |
| InChI | InChI=1S/C8H8O3/c1-3-4(2)6(10)8-7(11-8)5(3)9/h7-8H,1-2H3 |
| InChIKey | XZIUCJFYZXRYNN-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|