C8H14N2O — CID 130835408
1-(2,5-dimethyl-1H-pyrrol-3-yl)-N-methoxymethanamine (PubChem CID 130835408) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1H-pyrrol-3-yl)-N-methoxymethanamine.
| Compound Name | 1-(2,5-dimethyl-1H-pyrrol-3-yl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 130835408 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 1-(2,5-dimethyl-1H-pyrrol-3-yl)-N-methoxymethanamine |
| SMILES | CONCc1cc(C)[nH]c1C |
| InChI | InChI=1S/C8H14N2O/c1-6-4-8(5-9-11-3)7(2)10-6/h4,9-10H,5H2,1-3H3 |
| InChIKey | BRYFMVKAHBYUOF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|