C7H3ClN2O3 — CID 130840630
6-chloro-2-nitro-1,3-benzoxazole (PubChem CID 130840630) has the molecular formula C7H3ClN2O3 and a molecular weight of 198.57 g/mol. Its IUPAC name is 6-chloro-2-nitro-1,3-benzoxazole.
| Compound Name | 6-chloro-2-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 130840630 |
| Molecular Formula | C7H3ClN2O3 |
| Molecular Weight | 198.57 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 6-chloro-2-nitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C7H3ClN2O3/c8-4-1-2-5-6(3-4)13-7(9-5)10(11)12/h1-3H |
| InChIKey | KYGVPGYYFPWTJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|