About 6-chloro-2-nitro-1,3-benzoxazole
6-chloro-2-nitro-1,3-benzoxazole (PubChem CID 130840630) has the molecular formula C7H3ClN2O3
and a molecular weight of 198.57 g/mol. Its IUPAC name is 6-chloro-2-nitro-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-chloro-2-nitro-1,3-benzoxazole |
| PubChem CID | 130840630 |
| Molecular Formula | C7H3ClN2O3 |
| Molecular Weight | 198.57 g/mol |
| Exact Mass | 197.98 |
| IUPAC Name | 6-chloro-2-nitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C7H3ClN2O3/c8-4-1-2-5-6(3-4)13-7(9-5)10(11)12/h1-3H |
| InChIKey | KYGVPGYYFPWTJU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-nitro-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-nitro-1,3-benzoxazole?
The IUPAC name of 6-chloro-2-nitro-1,3-benzoxazole (CID 130840630) is 6-chloro-2-nitro-1,3-benzoxazole.
What is the SMILES notation for 6-chloro-2-nitro-1,3-benzoxazole?
The canonical SMILES for 6-chloro-2-nitro-1,3-benzoxazole is O=[N+]([O-])c1nc2ccc(Cl)cc2o1.
What is the InChIKey of 6-chloro-2-nitro-1,3-benzoxazole?
The InChIKey is KYGVPGYYFPWTJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN2O3/c8-4-1-2-5-6(3-4)13-7(9-5)10(11)12/h1-3H.
What are the key properties of 6-chloro-2-nitro-1,3-benzoxazole?
6-chloro-2-nitro-1,3-benzoxazole has a molecular weight of 198.57 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-nitro-1,3-benzoxazole is sourced from PubChem (CID 130840630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).