C8H10O3 — CID 130847459
(1R,4S,6S)-6-hydroxybicyclo[2.2.1]hept-2-ene-1-carboxylic acid (PubChem CID 130847459) has the molecular formula C8H10O3 and a molecular weight of 154.16 g/mol. Its IUPAC name is (1R,4S,6S)-6-hydroxybicyclo[2.2.1]hept-2-ene-1-carboxylic acid.
| Compound Name | (1R,4S,6S)-6-hydroxybicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 130847459 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | (1R,4S,6S)-6-hydroxybicyclo[2.2.1]hept-2-ene-1-carboxylic acid |
| SMILES | O=C(O)[C@]12C=C[C@H](C[C@@H]1O)C2 |
| InChI | InChI=1S/C8H10O3/c9-6-3-5-1-2-8(6,4-5)7(10)11/h1-2,5-6,9H,3-4H2,(H,10,11)/t5-,6+,8+/m1/s1 |
| InChIKey | LIILAWUBLWDGFK-CHKWXVPMSA-N |
| XLogP | 0.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|