C15H20N2O2 — CID 174429804
1-N,1-N-bis(prop-2-enyl)bicyclo[2.2.1]hept-5-ene-1,2-dicarboxamide (PubChem CID 174429804) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-N,1-N-bis(prop-2-enyl)bicyclo[2.2.1]hept-5-ene-1,2-dicarboxamide.
| Compound Name | 1-N,1-N-bis(prop-2-enyl)bicyclo[2.2.1]hept-5-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 174429804 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-N,1-N-bis(prop-2-enyl)bicyclo[2.2.1]hept-5-ene-1,2-dicarboxamide |
| SMILES | C=CCN(CC=C)C(=O)C12C=CC(CC1C(N)=O)C2 |
| InChI | InChI=1S/C15H20N2O2/c1-3-7-17(8-4-2)14(19)15-6-5-11(10-15)9-12(15)13(16)18/h3-6,11-12H,1-2,7-10H2,(H2,16,18) |
| InChIKey | HZQNVBWRCUEEDW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|