C9H12O2 — CID 131846039
(1R,2R,4S)-1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 131846039) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is (1R,2R,4S)-1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,4S)-1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 131846039 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | (1R,2R,4S)-1-methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | C[C@@]12C=C[C@@H](C[C@H]1C(=O)O)C2 |
| InChI | InChI=1S/C9H12O2/c1-9-3-2-6(5-9)4-7(9)8(10)11/h2-3,6-7H,4-5H2,1H3,(H,10,11)/t6-,7-,9-/m0/s1 |
| InChIKey | MZCFNSAAYVFCKY-ZKWXMUAHSA-N |
| XLogP | 1.67 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|