C6H12N2 — CID 130849467
(1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 130849467) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 130849467 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | C[C@@]12CN[C@@H](CN1)C2 |
| InChI | InChI=1S/C6H12N2/c1-6-2-5(3-8-6)7-4-6/h5,7-8H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | FMYVFSXWWJKLDS-PHDIDXHHSA-N |
| XLogP | -0.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |