About (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane
(1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 130849467) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 130849467 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | C[C@@]12CN[C@@H](CN1)C2 |
| InChI | InChI=1S/C6H12N2/c1-6-2-5(3-8-6)7-4-6/h5,7-8H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | FMYVFSXWWJKLDS-PHDIDXHHSA-N |
| XLogP | -0.29 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane (CID 130849467) is (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane is C[C@@]12CN[C@@H](CN1)C2.
What is the InChIKey of (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is FMYVFSXWWJKLDS-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H12N2/c1-6-2-5(3-8-6)7-4-6/h5,7-8H,2-4H2,1H3/t5-,6-/m1/s1.
What are the key properties of (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane?
(1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 112.18 g/mol, XLogP of -0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1-methyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 130849467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).