C8H5Br2NOS2 — CID 130857207
(4,5-dibromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130857207) has the molecular formula C8H5Br2NOS2 and a molecular weight of 355.08 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130857207 |
| Molecular Formula | C8H5Br2NOS2 |
| Molecular Weight | 355.08 g/mol |
| Exact Mass | 352.82 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C8H5Br2NOS2/c9-4-3-6(14-8(4)10)7(12)5-1-2-13-11-5/h1-3,7,12H |
| InChIKey | KGUZCKVFSNUJLR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.08 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |