C8H6BrNOS2 — CID 130906083
(3-bromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130906083) has the molecular formula C8H6BrNOS2 and a molecular weight of 276.18 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (3-bromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 130906083 |
| Molecular Formula | C8H6BrNOS2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 274.91 |
| IUPAC Name | (3-bromothiophen-2-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)c1sccc1Br |
| InChI | InChI=1S/C8H6BrNOS2/c9-5-1-3-12-8(5)7(11)6-2-4-13-10-6/h1-4,7,11H |
| InChIKey | BPEIOMUVXCKXLV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |