C10H20N2OS — CID 130857552
2,6-diethyl-N-methylmorpholine-4-carbothioamide (PubChem CID 130857552) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is 2,6-diethyl-N-methylmorpholine-4-carbothioamide.
| Compound Name | 2,6-diethyl-N-methylmorpholine-4-carbothioamide |
|---|---|
| PubChem CID | 130857552 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2,6-diethyl-N-methylmorpholine-4-carbothioamide |
| SMILES | CCC1CN(C(=S)NC)CC(CC)O1 |
| InChI | InChI=1S/C10H20N2OS/c1-4-8-6-12(10(14)11-3)7-9(5-2)13-8/h8-9H,4-7H2,1-3H3,(H,11,14) |
| InChIKey | DYRQRJHAVFPIHP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|