C8H16N4S2 — CID 2731758
1-N,4-N-dimethylpiperazine-1,4-dicarbothioamide (PubChem CID 2731758) has the molecular formula C8H16N4S2 and a molecular weight of 232.38 g/mol. Its IUPAC name is 1-N,4-N-dimethylpiperazine-1,4-dicarbothioamide.
| Compound Name | 1-N,4-N-dimethylpiperazine-1,4-dicarbothioamide |
|---|---|
| PubChem CID | 2731758 |
| Molecular Formula | C8H16N4S2 |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-N,4-N-dimethylpiperazine-1,4-dicarbothioamide |
| SMILES | CNC(=S)N1CCN(C(=S)NC)CC1 |
| InChI | InChI=1S/C8H16N4S2/c1-9-7(13)11-3-5-12(6-4-11)8(14)10-2/h3-6H2,1-2H3,(H,9,13)(H,10,14) |
| InChIKey | XQDUFKBXVMDXMJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|