C10H14BrFN2 — CID 130863016
(1S,2S)-1-(3-bromo-4-fluorophenyl)butane-1,2-diamine (PubChem CID 130863016) has the molecular formula C10H14BrFN2 and a molecular weight of 261.14 g/mol. Its IUPAC name is (1S,2S)-1-(3-bromo-4-fluorophenyl)butane-1,2-diamine.
| Compound Name | (1S,2S)-1-(3-bromo-4-fluorophenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 130863016 |
| Molecular Formula | C10H14BrFN2 |
| Molecular Weight | 261.14 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | (1S,2S)-1-(3-bromo-4-fluorophenyl)butane-1,2-diamine |
| SMILES | CC[C@H](N)[C@@H](N)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C10H14BrFN2/c1-2-9(13)10(14)6-3-4-8(12)7(11)5-6/h3-5,9-10H,2,13-14H2,1H3/t9-,10-/m0/s1 |
| InChIKey | OCXIJBBKRMBQTI-UWVGGRQHSA-N |
| XLogP | 2.33 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |