C13H19BrFN — CID 82922100
1-(3-bromo-4-fluorophenyl)-3-ethylpentan-1-amine (PubChem CID 82922100) has the molecular formula C13H19BrFN and a molecular weight of 288.20 g/mol. Its IUPAC name is 1-(3-bromo-4-fluorophenyl)-3-ethylpentan-1-amine.
| Compound Name | 1-(3-bromo-4-fluorophenyl)-3-ethylpentan-1-amine |
|---|---|
| PubChem CID | 82922100 |
| Molecular Formula | C13H19BrFN |
| Molecular Weight | 288.20 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 1-(3-bromo-4-fluorophenyl)-3-ethylpentan-1-amine |
| SMILES | CCC(CC)CC(N)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H19BrFN/c1-3-9(4-2)7-13(16)10-5-6-12(15)11(14)8-10/h5-6,8-9,13H,3-4,7,16H2,1-2H3 |
| InChIKey | FDMFKAVIBGDIIY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |