C7H13ClO — CID 13087284
4-chloro-3,3-dimethyloxane (PubChem CID 13087284) has the molecular formula C7H13ClO and a molecular weight of 148.63 g/mol. Its IUPAC name is 4-chloro-3,3-dimethyloxane.
| Compound Name | 4-chloro-3,3-dimethyloxane |
|---|---|
| PubChem CID | 13087284 |
| Molecular Formula | C7H13ClO |
| Molecular Weight | 148.63 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 4-chloro-3,3-dimethyloxane |
| SMILES | CC1(C)COCCC1Cl |
| InChI | InChI=1S/C7H13ClO/c1-7(2)5-9-4-3-6(7)8/h6H,3-5H2,1-2H3 |
| InChIKey | OFVSLNALGXOXJL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.63 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|