C12H21BO3 — CID 163409797
4,4,5,5-tetramethyl-2-(3-oxabicyclo[4.1.0]heptan-1-yl)-1,3,2-dioxaborolane (PubChem CID 163409797) has the molecular formula C12H21BO3 and a molecular weight of 224.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3-oxabicyclo[4.1.0]heptan-1-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3-oxabicyclo[4.1.0]heptan-1-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 163409797 |
| Molecular Formula | C12H21BO3 |
| Molecular Weight | 224.11 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3-oxabicyclo[4.1.0]heptan-1-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C23COCCC2C3)OC1(C)C |
| InChI | InChI=1S/C12H21BO3/c1-10(2)11(3,4)16-13(15-10)12-7-9(12)5-6-14-8-12/h9H,5-8H2,1-4H3 |
| InChIKey | ONZVRVOFIMOYNQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|