C9H18BrNO2 — CID 130874691
6-bromo-4-(1-methoxypropan-2-yl)-1,4-oxazepane (PubChem CID 130874691) has the molecular formula C9H18BrNO2 and a molecular weight of 252.15 g/mol. Its IUPAC name is 6-bromo-4-(1-methoxypropan-2-yl)-1,4-oxazepane.
| Compound Name | 6-bromo-4-(1-methoxypropan-2-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 130874691 |
| Molecular Formula | C9H18BrNO2 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 6-bromo-4-(1-methoxypropan-2-yl)-1,4-oxazepane |
| SMILES | COCC(C)N1CCOCC(Br)C1 |
| InChI | InChI=1S/C9H18BrNO2/c1-8(6-12-2)11-3-4-13-7-9(10)5-11/h8-9H,3-7H2,1-2H3 |
| InChIKey | UHMRIHXGJJYUQS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|