C14H41N2PSi4 — CID 13087712
bis[bis(trimethylsilyl)amino]phosphanylethane (PubChem CID 13087712) has the molecular formula C14H41N2PSi4 and a molecular weight of 380.81 g/mol. Its IUPAC name is bis[bis(trimethylsilyl)amino]phosphanylethane.
| Compound Name | bis[bis(trimethylsilyl)amino]phosphanylethane |
|---|---|
| PubChem CID | 13087712 |
| Molecular Formula | C14H41N2PSi4 |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | bis[bis(trimethylsilyl)amino]phosphanylethane |
| SMILES | CCP(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H41N2PSi4/c1-14-17(15(18(2,3)4)19(5,6)7)16(20(8,9)10)21(11,12)13/h14H2,1-13H3 |
| InChIKey | NNWQGWAXMHPUEO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|