C9H13NS2 — CID 130877389
1-[(5-methylsulfanylthiophen-2-yl)methyl]azetidine (PubChem CID 130877389) has the molecular formula C9H13NS2 and a molecular weight of 199.34 g/mol. Its IUPAC name is 1-[(5-methylsulfanylthiophen-2-yl)methyl]azetidine.
| Compound Name | 1-[(5-methylsulfanylthiophen-2-yl)methyl]azetidine |
|---|---|
| PubChem CID | 130877389 |
| Molecular Formula | C9H13NS2 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 1-[(5-methylsulfanylthiophen-2-yl)methyl]azetidine |
| SMILES | CSc1ccc(CN2CCC2)s1 |
| InChI | InChI=1S/C9H13NS2/c1-11-9-4-3-8(12-9)7-10-5-2-6-10/h3-4H,2,5-7H2,1H3 |
| InChIKey | SKEKRLHEJVDGEO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |