C10H19N3 — CID 130882676
3,3-dimethyl-1-(1H-pyrrol-2-yl)butane-1,2-diamine (PubChem CID 130882676) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 3,3-dimethyl-1-(1H-pyrrol-2-yl)butane-1,2-diamine.
| Compound Name | 3,3-dimethyl-1-(1H-pyrrol-2-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 130882676 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3,3-dimethyl-1-(1H-pyrrol-2-yl)butane-1,2-diamine |
| SMILES | CC(C)(C)C(N)C(N)c1ccc[nH]1 |
| InChI | InChI=1S/C10H19N3/c1-10(2,3)9(12)8(11)7-5-4-6-13-7/h4-6,8-9,13H,11-12H2,1-3H3 |
| InChIKey | YGHPFSNYKYJTIG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |