C11H14N2OS — CID 13089119
2-[(5-methoxy-1H-indol-3-yl)sulfanyl]ethanamine (PubChem CID 13089119) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-[(5-methoxy-1H-indol-3-yl)sulfanyl]ethanamine.
| Compound Name | 2-[(5-methoxy-1H-indol-3-yl)sulfanyl]ethanamine |
|---|---|
| PubChem CID | 13089119 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-[(5-methoxy-1H-indol-3-yl)sulfanyl]ethanamine |
| SMILES | COc1ccc2[nH]cc(SCCN)c2c1 |
| InChI | InChI=1S/C11H14N2OS/c1-14-8-2-3-10-9(6-8)11(7-13-10)15-5-4-12/h2-3,6-7,13H,4-5,12H2,1H3 |
| InChIKey | DGXORTSKCZBZRZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |