C11H16O — CID 130891455
(1R,5S,6R,7S)-6-methyltricyclo[5.3.0.01,5]decan-2-one (PubChem CID 130891455) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1R,5S,6R,7S)-6-methyltricyclo[5.3.0.01,5]decan-2-one.
| Compound Name | (1R,5S,6R,7S)-6-methyltricyclo[5.3.0.01,5]decan-2-one |
|---|---|
| PubChem CID | 130891455 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1R,5S,6R,7S)-6-methyltricyclo[5.3.0.01,5]decan-2-one |
| SMILES | C[C@@H]1[C@@H]2CCC[C@@]23C(=O)CC[C@@H]13 |
| InChI | InChI=1S/C11H16O/c1-7-8-3-2-6-11(8)9(7)4-5-10(11)12/h7-9H,2-6H2,1H3/t7-,8+,9+,11-/m1/s1 |
| InChIKey | GHQOKQUSWPZKHD-UYAYMFIHSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |