C10H19F2NO — CID 130891626
1-(2,2-difluoroethyl)-6,6-dimethylazepan-4-ol (PubChem CID 130891626) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-6,6-dimethylazepan-4-ol.
| Compound Name | 1-(2,2-difluoroethyl)-6,6-dimethylazepan-4-ol |
|---|---|
| PubChem CID | 130891626 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-(2,2-difluoroethyl)-6,6-dimethylazepan-4-ol |
| SMILES | CC1(C)CC(O)CCN(CC(F)F)C1 |
| InChI | InChI=1S/C10H19F2NO/c1-10(2)5-8(14)3-4-13(7-10)6-9(11)12/h8-9,14H,3-7H2,1-2H3 |
| InChIKey | SRNQROWRDVIESR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |