C12H24F2NO+ — CID 123245386
4-ethoxy-5,5-difluoro-1,1,3,3-tetramethylazepan-1-ium (PubChem CID 123245386) has the molecular formula C12H24F2NO+ and a molecular weight of 236.33 g/mol. Its IUPAC name is 4-ethoxy-5,5-difluoro-1,1,3,3-tetramethylazepan-1-ium.
| Compound Name | 4-ethoxy-5,5-difluoro-1,1,3,3-tetramethylazepan-1-ium |
|---|---|
| PubChem CID | 123245386 |
| Molecular Formula | C12H24F2NO+ |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 4-ethoxy-5,5-difluoro-1,1,3,3-tetramethylazepan-1-ium |
| SMILES | CCOC1C(C)(C)C[N+](C)(C)CCC1(F)F |
| InChI | InChI=1S/C12H24F2NO/c1-6-16-10-11(2,3)9-15(4,5)8-7-12(10,13)14/h10H,6-9H2,1-5H3/q+1 |
| InChIKey | BJHUHPOQRGVCTF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|