C18H22F15NO — CID 145366182
1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentyl]-3,6-bis(trifluoromethyl)azepane (PubChem CID 145366182) has the molecular formula C18H22F15NO and a molecular weight of 553.35 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentyl]-3,6-bis(trifluoromethyl)azepane.
| Compound Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentyl]-3,6-bis(trifluoromethyl)azepane |
|---|---|
| PubChem CID | 145366182 |
| Molecular Formula | C18H22F15NO |
| Molecular Weight | 553.35 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)pentyl]-3,6-bis(trifluoromethyl)azepane |
| SMILES | CCC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CC(C(F)(F)F)CCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C18H22F15NO/c1-3-11(35-8(2)14(21,22)12(19)18(31,32)33)15(23,24)13(20)34-6-9(16(25,26)27)4-5-10(7-34)17(28,29)30/h8-13H,3-7H2,1-2H3 |
| InChIKey | DQEYUGURXWBFAC-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.35 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|