C15H22F9NO — CID 130418396
1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]azepane (PubChem CID 130418396) has the molecular formula C15H22F9NO and a molecular weight of 403.33 g/mol. Its IUPAC name is 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]azepane.
| Compound Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]azepane |
|---|---|
| PubChem CID | 130418396 |
| Molecular Formula | C15H22F9NO |
| Molecular Weight | 403.33 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 1-[1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)butyl]azepane |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N1CCCCCC1 |
| InChI | InChI=1S/C15H22F9NO/c1-9(13(18,19)11(16)15(22,23)24)26-10(2)14(20,21)12(17)25-7-5-3-4-6-8-25/h9-12H,3-8H2,1-2H3 |
| InChIKey | VTSCLDFXQBRTGU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|