C12H18O2 — CID 130892311
spiro[bicyclo[2.2.2]octane-2,5'-oxolane]-2'-carbaldehyde (PubChem CID 130892311) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is spiro[bicyclo[2.2.2]octane-2,5'-oxolane]-2'-carbaldehyde.
| Compound Name | spiro[bicyclo[2.2.2]octane-2,5'-oxolane]-2'-carbaldehyde |
|---|---|
| PubChem CID | 130892311 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | spiro[bicyclo[2.2.2]octane-2,5'-oxolane]-2'-carbaldehyde |
| SMILES | O=CC1CCC2(CC3CCC2CC3)O1 |
| InChI | InChI=1S/C12H18O2/c13-8-11-5-6-12(14-11)7-9-1-3-10(12)4-2-9/h8-11H,1-7H2 |
| InChIKey | WBUXAPVYQVJYMZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|