About spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine
spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine (PubChem CID 129056826) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine.
Molecular Properties
| Compound Name | spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
| PubChem CID | 129056826 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
| SMILES | NN1CC2(CC3CCC2CC3)ON1 |
| InChI | InChI=1S/C9H17N3O/c10-12-6-9(13-11-12)5-7-1-3-8(9)4-2-7/h7-8,11H,1-6,10H2 |
| InChIKey | OEWWRBLKDUCDED-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The IUPAC name of spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine (CID 129056826) is spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine.
What is the SMILES notation for spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The canonical SMILES for spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine is NN1CC2(CC3CCC2CC3)ON1.
What is the InChIKey of spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
The InChIKey is OEWWRBLKDUCDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c10-12-6-9(13-11-12)5-7-1-3-8(9)4-2-7/h7-8,11H,1-6,10H2.
What are the key properties of spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine?
spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine has a molecular weight of 183.25 g/mol, XLogP of 0.56, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine is sourced from PubChem (CID 129056826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).