C9H17N3O — CID 129056826
spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine (PubChem CID 129056826) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine.
| Compound Name | spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
|---|---|
| PubChem CID | 129056826 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | spiro[bicyclo[2.2.2]octane-2,5'-oxadiazolidine]-3'-amine |
| SMILES | NN1CC2(CC3CCC2CC3)ON1 |
| InChI | InChI=1S/C9H17N3O/c10-12-6-9(13-11-12)5-7-1-3-8(9)4-2-7/h7-8,11H,1-6,10H2 |
| InChIKey | OEWWRBLKDUCDED-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|