C27H24F3NO4 — CID 1308983
9-(4-hydroxy-3-methoxyphenyl)-10-[3-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 1308983) has the molecular formula C27H24F3NO4 and a molecular weight of 483.49 g/mol. Its IUPAC name is 9-(4-hydroxy-3-methoxyphenyl)-10-[3-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 9-(4-hydroxy-3-methoxyphenyl)-10-[3-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 1308983 |
| Molecular Formula | C27H24F3NO4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 9-(4-hydroxy-3-methoxyphenyl)-10-[3-(trifluoromethyl)phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | COc1cc(C2C3=C(CCCC3=O)N(c3cccc(C(F)(F)F)c3)C3=C2C(=O)CCC3)ccc1O |
| InChI | InChI=1S/C27H24F3NO4/c1-35-23-13-15(11-12-20(23)32)24-25-18(7-3-9-21(25)33)31(19-8-4-10-22(34)26(19)24)17-6-2-5-16(14-17)27(28,29)30/h2,5-6,11-14,24,32H,3-4,7-10H2,1H3 |
| InChIKey | GWHDOFYCLSGREG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |