C6H11N3S — CID 130899446
1-(1,2-thiazol-5-yl)propylhydrazine (PubChem CID 130899446) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-(1,2-thiazol-5-yl)propylhydrazine.
| Compound Name | 1-(1,2-thiazol-5-yl)propylhydrazine |
|---|---|
| PubChem CID | 130899446 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 1-(1,2-thiazol-5-yl)propylhydrazine |
| SMILES | CCC(NN)c1ccns1 |
| InChI | InChI=1S/C6H11N3S/c1-2-5(9-7)6-3-4-8-10-6/h3-5,9H,2,7H2,1H3 |
| InChIKey | OTVDKKPYUPBHRM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|