C11H18N2S — CID 130900895
(3-ethylcyclopentyl)-(1,2-thiazol-5-yl)methanamine (PubChem CID 130900895) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is (3-ethylcyclopentyl)-(1,2-thiazol-5-yl)methanamine.
| Compound Name | (3-ethylcyclopentyl)-(1,2-thiazol-5-yl)methanamine |
|---|---|
| PubChem CID | 130900895 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (3-ethylcyclopentyl)-(1,2-thiazol-5-yl)methanamine |
| SMILES | CCC1CCC(C(N)c2ccns2)C1 |
| InChI | InChI=1S/C11H18N2S/c1-2-8-3-4-9(7-8)11(12)10-5-6-13-14-10/h5-6,8-9,11H,2-4,7,12H2,1H3 |
| InChIKey | QIKOAIBCZYVHPU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |