C12H14N2O — CID 130900967
1-(6-amino-2-pyridinyl)-2-(cyclopenten-1-yl)ethanone (PubChem CID 130900967) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-(6-amino-2-pyridinyl)-2-(cyclopenten-1-yl)ethanone.
| Compound Name | 1-(6-amino-2-pyridinyl)-2-(cyclopenten-1-yl)ethanone |
|---|---|
| PubChem CID | 130900967 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 1-(6-amino-2-pyridinyl)-2-(cyclopenten-1-yl)ethanone |
| SMILES | Nc1cccc(C(=O)CC2=CCCC2)n1 |
| InChI | InChI=1S/C12H14N2O/c13-12-7-3-6-10(14-12)11(15)8-9-4-1-2-5-9/h3-4,6-7H,1-2,5,8H2,(H2,13,14) |
| InChIKey | IECGQEVDKFSQHO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|