C12H16N2O — CID 130987790
2-(cyclopenten-1-yl)-1-(1,3-dimethylpyrazol-4-yl)ethanone (PubChem CID 130987790) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(cyclopenten-1-yl)-1-(1,3-dimethylpyrazol-4-yl)ethanone.
| Compound Name | 2-(cyclopenten-1-yl)-1-(1,3-dimethylpyrazol-4-yl)ethanone |
|---|---|
| PubChem CID | 130987790 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-(cyclopenten-1-yl)-1-(1,3-dimethylpyrazol-4-yl)ethanone |
| SMILES | Cc1nn(C)cc1C(=O)CC1=CCCC1 |
| InChI | InChI=1S/C12H16N2O/c1-9-11(8-14(2)13-9)12(15)7-10-5-3-4-6-10/h5,8H,3-4,6-7H2,1-2H3 |
| InChIKey | URUZRQLOBFKMFH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|