About (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone
(3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone (PubChem CID 130905765) has the molecular formula C8H7F2NOS
and a molecular weight of 203.21 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone.
Analyze (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone?
The IUPAC name of (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone (CID 130905765) is (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone.
What is the SMILES notation for (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone?
The canonical SMILES for (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone is O=C(c1cscn1)C1CC(F)(F)C1.
What is the InChIKey of (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone?
The InChIKey is JLFKSVIIQYXZGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NOS/c9-8(10)1-5(2-8)7(12)6-3-13-4-11-6/h3-5H,1-2H2.
What are the key properties of (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone?
(3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone has a molecular weight of 203.21 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-difluorocyclobutyl)-(1,3-thiazol-4-yl)methanone is sourced from PubChem (CID 130905765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).