C10H11F2NOS — CID 130729567
(3,3-difluorocyclohexyl)-(1,3-thiazol-4-yl)methanone (PubChem CID 130729567) has the molecular formula C10H11F2NOS and a molecular weight of 231.27 g/mol. Its IUPAC name is (3,3-difluorocyclohexyl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (3,3-difluorocyclohexyl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 130729567 |
| Molecular Formula | C10H11F2NOS |
| Molecular Weight | 231.27 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | (3,3-difluorocyclohexyl)-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C10H11F2NOS/c11-10(12)3-1-2-7(4-10)9(14)8-5-15-6-13-8/h5-7H,1-4H2 |
| InChIKey | HAWPIJOCPSQFGX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |