About trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one
trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one (PubChem CID 130906180) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one |
| PubChem CID | 130906180 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one |
| SMILES | CO[C@]1(C)CC(=O)C[C@@H](C)C1 |
| InChI | InChI=1S/C9H16O2/c1-7-4-8(10)6-9(2,5-7)11-3/h7H,4-6H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | VRWJSBJPZAMQFL-APPZFPTMSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one?
The IUPAC name of trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one (CID 130906180) is trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one.
What is the SMILES notation for trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one?
The canonical SMILES for trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one is CO[C@]1(C)CC(=O)C[C@@H](C)C1.
What is the InChIKey of trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one?
The InChIKey is VRWJSBJPZAMQFL-APPZFPTMSA-N. The full InChI is InChI=1S/C9H16O2/c1-7-4-8(10)6-9(2,5-7)11-3/h7H,4-6H2,1-3H3/t7-,9+/m1/s1.
What are the key properties of trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one?
trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,5S)-3-methoxy-3,5-dimethylcyclohexan-1-one is sourced from PubChem (CID 130906180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).