C9H14O4 — CID 142927950
2-(1-hydroxy-3-methyl-5-oxocyclohexyl)acetic acid (PubChem CID 142927950) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 2-(1-hydroxy-3-methyl-5-oxocyclohexyl)acetic acid.
| Compound Name | 2-(1-hydroxy-3-methyl-5-oxocyclohexyl)acetic acid |
|---|---|
| PubChem CID | 142927950 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 2-(1-hydroxy-3-methyl-5-oxocyclohexyl)acetic acid |
| SMILES | CC1CC(=O)CC(O)(CC(=O)O)C1 |
| InChI | InChI=1S/C9H14O4/c1-6-2-7(10)4-9(13,3-6)5-8(11)12/h6,13H,2-5H2,1H3,(H,11,12) |
| InChIKey | BEVNLCYCNJNPLQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |